N,2-bis[2-(3,4-dimethoxyphenyl)ethyl]-3-oxo-2,3-dihydro-1H-isoindole-1-carboxamide
Chemical Structure Depiction of
N,2-bis[2-(3,4-dimethoxyphenyl)ethyl]-3-oxo-2,3-dihydro-1H-isoindole-1-carboxamide
N,2-bis[2-(3,4-dimethoxyphenyl)ethyl]-3-oxo-2,3-dihydro-1H-isoindole-1-carboxamide
Compound characteristics
| Compound ID: | K786-2426 |
| Compound Name: | N,2-bis[2-(3,4-dimethoxyphenyl)ethyl]-3-oxo-2,3-dihydro-1H-isoindole-1-carboxamide |
| Molecular Weight: | 504.58 |
| Molecular Formula: | C29 H32 N2 O6 |
| Smiles: | COc1ccc(CCNC(C2c3ccccc3C(N2CCc2ccc(c(c2)OC)OC)=O)=O)cc1OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8845 |
| logD: | 2.8845 |
| logSw: | -3.4879 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.044 |
| InChI Key: | PRLIIEFWMYBSIS-MHZLTWQESA-N |