N-{2-[(4-chlorophenyl)sulfanyl]-5-(3,5-dimethylpiperidine-1-carbonyl)phenyl}acetamide
Chemical Structure Depiction of
N-{2-[(4-chlorophenyl)sulfanyl]-5-(3,5-dimethylpiperidine-1-carbonyl)phenyl}acetamide
N-{2-[(4-chlorophenyl)sulfanyl]-5-(3,5-dimethylpiperidine-1-carbonyl)phenyl}acetamide
Compound characteristics
| Compound ID: | K786-2915 |
| Compound Name: | N-{2-[(4-chlorophenyl)sulfanyl]-5-(3,5-dimethylpiperidine-1-carbonyl)phenyl}acetamide |
| Molecular Weight: | 416.97 |
| Molecular Formula: | C22 H25 Cl N2 O2 S |
| Smiles: | CC1CC(C)CN(C1)C(c1ccc(c(c1)NC(C)=O)Sc1ccc(cc1)[Cl])=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.8077 |
| logD: | 4.8077 |
| logSw: | -4.8723 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.046 |
| InChI Key: | HCSXFKZIVDQOSV-UHFFFAOYSA-N |