N-[(4-methoxyphenyl)methyl]-3-{[(4-methylphenyl)methyl]sulfanyl}propanamide
Chemical Structure Depiction of
N-[(4-methoxyphenyl)methyl]-3-{[(4-methylphenyl)methyl]sulfanyl}propanamide
N-[(4-methoxyphenyl)methyl]-3-{[(4-methylphenyl)methyl]sulfanyl}propanamide
Compound characteristics
| Compound ID: | K786-6244 |
| Compound Name: | N-[(4-methoxyphenyl)methyl]-3-{[(4-methylphenyl)methyl]sulfanyl}propanamide |
| Molecular Weight: | 329.46 |
| Molecular Formula: | C19 H23 N O2 S |
| Smiles: | Cc1ccc(CSCCC(NCc2ccc(cc2)OC)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.6689 |
| logD: | 3.6689 |
| logSw: | -3.7893 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.982 |
| InChI Key: | LMYGBGMTAGVCAZ-UHFFFAOYSA-N |