10-[(2,5-dimethylphenyl)methyl]-N-[(4-ethylphenyl)methyl]-11-oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxamide
Chemical Structure Depiction of
10-[(2,5-dimethylphenyl)methyl]-N-[(4-ethylphenyl)methyl]-11-oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxamide
10-[(2,5-dimethylphenyl)methyl]-N-[(4-ethylphenyl)methyl]-11-oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxamide
Compound characteristics
| Compound ID: | K786-6668 |
| Compound Name: | 10-[(2,5-dimethylphenyl)methyl]-N-[(4-ethylphenyl)methyl]-11-oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxamide |
| Molecular Weight: | 506.67 |
| Molecular Formula: | C32 H30 N2 O2 S |
| Smiles: | CCc1ccc(CNC(c2ccc3c(c2)N(Cc2cc(C)ccc2C)C(c2ccccc2S3)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 7.821 |
| logD: | 7.8209 |
| logSw: | -5.5761 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.814 |
| InChI Key: | CWUDEXYCFXQLJM-UHFFFAOYSA-N |