10-[(2-chloro-4-fluorophenyl)methyl]-8-(piperidine-1-carbonyl)dibenzo[b,f][1,4]thiazepin-11(10H)-one
Chemical Structure Depiction of
10-[(2-chloro-4-fluorophenyl)methyl]-8-(piperidine-1-carbonyl)dibenzo[b,f][1,4]thiazepin-11(10H)-one
10-[(2-chloro-4-fluorophenyl)methyl]-8-(piperidine-1-carbonyl)dibenzo[b,f][1,4]thiazepin-11(10H)-one
Compound characteristics
| Compound ID: | K786-7130 |
| Compound Name: | 10-[(2-chloro-4-fluorophenyl)methyl]-8-(piperidine-1-carbonyl)dibenzo[b,f][1,4]thiazepin-11(10H)-one |
| Molecular Weight: | 480.99 |
| Molecular Formula: | C26 H22 Cl F N2 O2 S |
| Smiles: | C1CCN(CC1)C(c1ccc2c(c1)N(Cc1ccc(cc1[Cl])F)C(c1ccccc1S2)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.9001 |
| logD: | 5.9001 |
| logSw: | -5.9052 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 32.049 |
| InChI Key: | IYASIGDCQJUFDN-UHFFFAOYSA-N |