N-(3-ethoxypropyl)-2-[(4-ethylphenyl)sulfanyl]quinoline-4-carboxamide
Chemical Structure Depiction of
N-(3-ethoxypropyl)-2-[(4-ethylphenyl)sulfanyl]quinoline-4-carboxamide
N-(3-ethoxypropyl)-2-[(4-ethylphenyl)sulfanyl]quinoline-4-carboxamide
Compound characteristics
| Compound ID: | K786-9014 |
| Compound Name: | N-(3-ethoxypropyl)-2-[(4-ethylphenyl)sulfanyl]quinoline-4-carboxamide |
| Molecular Weight: | 394.53 |
| Molecular Formula: | C23 H26 N2 O2 S |
| Smiles: | CCc1ccc(cc1)Sc1cc(C(NCCCOCC)=O)c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 5.7955 |
| logD: | 5.7954 |
| logSw: | -5.6273 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.162 |
| InChI Key: | MSDXOUWITCVCMI-UHFFFAOYSA-N |