(1,4-dioxa-8-azaspiro[4.5]decan-8-yl){2-[(4-ethylphenyl)sulfanyl]quinolin-4-yl}methanone
Chemical Structure Depiction of
(1,4-dioxa-8-azaspiro[4.5]decan-8-yl){2-[(4-ethylphenyl)sulfanyl]quinolin-4-yl}methanone
(1,4-dioxa-8-azaspiro[4.5]decan-8-yl){2-[(4-ethylphenyl)sulfanyl]quinolin-4-yl}methanone
Compound characteristics
| Compound ID: | K786-9029 |
| Compound Name: | (1,4-dioxa-8-azaspiro[4.5]decan-8-yl){2-[(4-ethylphenyl)sulfanyl]quinolin-4-yl}methanone |
| Molecular Weight: | 434.56 |
| Molecular Formula: | C25 H26 N2 O3 S |
| Smiles: | CCc1ccc(cc1)Sc1cc(C(N2CCC3(CC2)OCCO3)=O)c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 5.1243 |
| logD: | 5.1243 |
| logSw: | -5.13 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 38.744 |
| InChI Key: | AQUINDLDAGUZLA-UHFFFAOYSA-N |