N-(3,5-difluorophenyl)-N'-[(1-methyl-1H-pyrrol-2-yl)methyl]thiourea
Chemical Structure Depiction of
N-(3,5-difluorophenyl)-N'-[(1-methyl-1H-pyrrol-2-yl)methyl]thiourea
N-(3,5-difluorophenyl)-N'-[(1-methyl-1H-pyrrol-2-yl)methyl]thiourea
Compound characteristics
| Compound ID: | K788-0592 |
| Compound Name: | N-(3,5-difluorophenyl)-N'-[(1-methyl-1H-pyrrol-2-yl)methyl]thiourea |
| Molecular Weight: | 281.32 |
| Molecular Formula: | C13 H13 F2 N3 S |
| Smiles: | Cn1cccc1CNC(Nc1cc(cc(c1)F)F)=S |
| Stereo: | ACHIRAL |
| logP: | 3.2226 |
| logD: | 3.2225 |
| logSw: | -3.3405 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 23.2808 |
| InChI Key: | QJEFZTFCLQUFOH-UHFFFAOYSA-N |