N'-(3-chloro-4-fluorophenyl)-N-[2-(dimethylamino)ethyl]-N-[1-(pyridin-4-yl)ethyl]thiourea
Chemical Structure Depiction of
N'-(3-chloro-4-fluorophenyl)-N-[2-(dimethylamino)ethyl]-N-[1-(pyridin-4-yl)ethyl]thiourea
N'-(3-chloro-4-fluorophenyl)-N-[2-(dimethylamino)ethyl]-N-[1-(pyridin-4-yl)ethyl]thiourea
Compound characteristics
| Compound ID: | K788-1549 |
| Compound Name: | N'-(3-chloro-4-fluorophenyl)-N-[2-(dimethylamino)ethyl]-N-[1-(pyridin-4-yl)ethyl]thiourea |
| Molecular Weight: | 380.91 |
| Molecular Formula: | C18 H22 Cl F N4 S |
| Smiles: | CC(c1ccncc1)N(CCN(C)C)C(Nc1ccc(c(c1)[Cl])F)=S |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8557 |
| logD: | 1.6343 |
| logSw: | -4.227 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.3357 |
| InChI Key: | DWNDLMGUMOVQAU-ZDUSSCGKSA-N |