11-oxo-N-(1-phenylethyl)-10-(prop-2-en-1-yl)-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxamide
Chemical Structure Depiction of
11-oxo-N-(1-phenylethyl)-10-(prop-2-en-1-yl)-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxamide
11-oxo-N-(1-phenylethyl)-10-(prop-2-en-1-yl)-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxamide
Compound characteristics
| Compound ID: | K788-1624 |
| Compound Name: | 11-oxo-N-(1-phenylethyl)-10-(prop-2-en-1-yl)-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxamide |
| Molecular Weight: | 414.53 |
| Molecular Formula: | C25 H22 N2 O2 S |
| Smiles: | CC(c1ccccc1)NC(c1ccc2c(c1)N(CC=C)C(c1ccccc1S2)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9877 |
| logD: | 4.9877 |
| logSw: | -4.4826 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.227 |
| InChI Key: | VAKNLZSRTQOULD-KRWDZBQOSA-N |