4-{[(benzenesulfonyl)amino]methyl}-N-[1-(4-butoxyphenyl)ethyl]cyclohexane-1-carboxamide
Chemical Structure Depiction of
4-{[(benzenesulfonyl)amino]methyl}-N-[1-(4-butoxyphenyl)ethyl]cyclohexane-1-carboxamide
4-{[(benzenesulfonyl)amino]methyl}-N-[1-(4-butoxyphenyl)ethyl]cyclohexane-1-carboxamide
Compound characteristics
| Compound ID: | K788-2888 |
| Compound Name: | 4-{[(benzenesulfonyl)amino]methyl}-N-[1-(4-butoxyphenyl)ethyl]cyclohexane-1-carboxamide |
| Molecular Weight: | 472.65 |
| Molecular Formula: | C26 H36 N2 O4 S |
| Smiles: | CCCCOc1ccc(cc1)C(C)NC(C1CCC(CC1)CNS(c1ccccc1)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3558 |
| logD: | 5.3558 |
| logSw: | -5.3233 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.183 |
| InChI Key: | LKPKSEOJEXMRPH-ZJOBEGKPSA-N |