N-[2-(3,4-diethoxyphenyl)ethyl]-6-[(4-ethoxyphenyl)sulfamoyl]-4-oxo-1,4-dihydroquinoline-3-carboxamide
Chemical Structure Depiction of
N-[2-(3,4-diethoxyphenyl)ethyl]-6-[(4-ethoxyphenyl)sulfamoyl]-4-oxo-1,4-dihydroquinoline-3-carboxamide
N-[2-(3,4-diethoxyphenyl)ethyl]-6-[(4-ethoxyphenyl)sulfamoyl]-4-oxo-1,4-dihydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | K788-3982 |
| Compound Name: | N-[2-(3,4-diethoxyphenyl)ethyl]-6-[(4-ethoxyphenyl)sulfamoyl]-4-oxo-1,4-dihydroquinoline-3-carboxamide |
| Molecular Weight: | 579.67 |
| Molecular Formula: | C30 H33 N3 O7 S |
| Smiles: | CCOc1ccc(cc1)NS(c1ccc2c(c1)C(C(=CN2)C(NCCc1ccc(c(c1)OCC)OCC)=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4719 |
| logD: | 2.4109 |
| logSw: | -3.8912 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 110.806 |
| InChI Key: | YYUKAMONXBIDMA-UHFFFAOYSA-N |