N-[3-(cyclohexylsulfanyl)propyl]-2-{2-[(3-fluorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}acetamide
Chemical Structure Depiction of
N-[3-(cyclohexylsulfanyl)propyl]-2-{2-[(3-fluorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}acetamide
N-[3-(cyclohexylsulfanyl)propyl]-2-{2-[(3-fluorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}acetamide
Compound characteristics
| Compound ID: | K788-4992 |
| Compound Name: | N-[3-(cyclohexylsulfanyl)propyl]-2-{2-[(3-fluorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}acetamide |
| Molecular Weight: | 468.59 |
| Molecular Formula: | C26 H29 F N2 O3 S |
| Smiles: | C1CCC(CC1)SCCCNC(CN1C(/C(=C\c2cccc(c2)F)Oc2ccccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8785 |
| logD: | 4.8785 |
| logSw: | -4.6726 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.538 |
| InChI Key: | PNLNWNYQMQSSND-UHFFFAOYSA-N |