N-(2,2-dimethoxyethyl)-3-[(4-methylbenzene-1-sulfonyl)amino]-4-(piperidin-1-yl)benzamide
Chemical Structure Depiction of
N-(2,2-dimethoxyethyl)-3-[(4-methylbenzene-1-sulfonyl)amino]-4-(piperidin-1-yl)benzamide
N-(2,2-dimethoxyethyl)-3-[(4-methylbenzene-1-sulfonyl)amino]-4-(piperidin-1-yl)benzamide
Compound characteristics
| Compound ID: | K788-5079 |
| Compound Name: | N-(2,2-dimethoxyethyl)-3-[(4-methylbenzene-1-sulfonyl)amino]-4-(piperidin-1-yl)benzamide |
| Molecular Weight: | 461.58 |
| Molecular Formula: | C23 H31 N3 O5 S |
| Smiles: | Cc1ccc(cc1)S(Nc1cc(ccc1N1CCCCC1)C(NCC(OC)OC)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1013 |
| logD: | 1.2742 |
| logSw: | -3.6448 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 83.521 |
| InChI Key: | JADMPHUEDRVRER-UHFFFAOYSA-N |