N-(butan-2-yl)-N-[(1-butyl-1,2,3,4-tetrahydroquinolin-6-yl)methyl]-N'-(3-chloro-2-methylphenyl)thiourea
Chemical Structure Depiction of
N-(butan-2-yl)-N-[(1-butyl-1,2,3,4-tetrahydroquinolin-6-yl)methyl]-N'-(3-chloro-2-methylphenyl)thiourea
N-(butan-2-yl)-N-[(1-butyl-1,2,3,4-tetrahydroquinolin-6-yl)methyl]-N'-(3-chloro-2-methylphenyl)thiourea
Compound characteristics
| Compound ID: | K788-5348 |
| Compound Name: | N-(butan-2-yl)-N-[(1-butyl-1,2,3,4-tetrahydroquinolin-6-yl)methyl]-N'-(3-chloro-2-methylphenyl)thiourea |
| Molecular Weight: | 458.11 |
| Molecular Formula: | C26 H36 Cl N3 S |
| Smiles: | CCCCN1CCCc2cc(CN(C(C)CC)C(Nc3cccc(c3C)[Cl])=S)ccc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 7.8149 |
| logD: | 7.3408 |
| logSw: | -6.6738 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 12.1426 |
| InChI Key: | HGZCMCSDAPOSMY-IBGZPJMESA-N |