N-[3-(diethylamino)propyl]-N-[(1-propyl-1,2,3,4-tetrahydroquinolin-6-yl)methyl]-N'-[3-(trifluoromethyl)phenyl]thiourea
Chemical Structure Depiction of
N-[3-(diethylamino)propyl]-N-[(1-propyl-1,2,3,4-tetrahydroquinolin-6-yl)methyl]-N'-[3-(trifluoromethyl)phenyl]thiourea
N-[3-(diethylamino)propyl]-N-[(1-propyl-1,2,3,4-tetrahydroquinolin-6-yl)methyl]-N'-[3-(trifluoromethyl)phenyl]thiourea
Compound characteristics
| Compound ID: | K788-5500 |
| Compound Name: | N-[3-(diethylamino)propyl]-N-[(1-propyl-1,2,3,4-tetrahydroquinolin-6-yl)methyl]-N'-[3-(trifluoromethyl)phenyl]thiourea |
| Molecular Weight: | 520.7 |
| Molecular Formula: | C28 H39 F3 N4 S |
| Smiles: | CCCN1CCCc2cc(CN(CCCN(CC)CC)C(Nc3cccc(c3)C(F)(F)F)=S)ccc12 |
| Stereo: | ACHIRAL |
| logP: | 6.9499 |
| logD: | 4.7636 |
| logSw: | -5.9757 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 16.9017 |
| InChI Key: | SSJKOKTUFGHANM-UHFFFAOYSA-N |