N-(butan-2-yl)-4-({4-[(4-methylphenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-ylidene}methyl)benzamide
Chemical Structure Depiction of
N-(butan-2-yl)-4-({4-[(4-methylphenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-ylidene}methyl)benzamide
N-(butan-2-yl)-4-({4-[(4-methylphenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-ylidene}methyl)benzamide
Compound characteristics
| Compound ID: | K788-5748 |
| Compound Name: | N-(butan-2-yl)-4-({4-[(4-methylphenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-ylidene}methyl)benzamide |
| Molecular Weight: | 440.54 |
| Molecular Formula: | C28 H28 N2 O3 |
| Smiles: | CCC(C)NC(c1ccc(\C=C2/C(N(Cc3ccc(C)cc3)c3ccccc3O2)=O)cc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2147 |
| logD: | 5.2147 |
| logSw: | -5.1174 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.159 |
| InChI Key: | ISJFROQONCIZMI-FQEVSTJZSA-N |