N-[(4-fluorophenyl)methyl]-2-{4-[(4-fluorophenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl}propanamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-2-{4-[(4-fluorophenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl}propanamide
N-[(4-fluorophenyl)methyl]-2-{4-[(4-fluorophenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl}propanamide
Compound characteristics
| Compound ID: | K788-5762 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-2-{4-[(4-fluorophenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl}propanamide |
| Molecular Weight: | 452.52 |
| Molecular Formula: | C25 H22 F2 N2 O2 S |
| Smiles: | CC(C1C(N(Cc2ccc(cc2)F)c2ccccc2S1)=O)C(NCc1ccc(cc1)F)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.3149 |
| logD: | 4.3149 |
| logSw: | -4.1943 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.754 |
| InChI Key: | SKNJTKUSPZOPBI-UHFFFAOYSA-N |