N-{3-[benzyl(methyl)amino]propyl}-2-(3,4-dimethoxyanilino)quinoline-4-carboxamide
Chemical Structure Depiction of
N-{3-[benzyl(methyl)amino]propyl}-2-(3,4-dimethoxyanilino)quinoline-4-carboxamide
N-{3-[benzyl(methyl)amino]propyl}-2-(3,4-dimethoxyanilino)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | K788-6014 |
| Compound Name: | N-{3-[benzyl(methyl)amino]propyl}-2-(3,4-dimethoxyanilino)quinoline-4-carboxamide |
| Molecular Weight: | 484.6 |
| Molecular Formula: | C29 H32 N4 O3 |
| Smiles: | CN(CCCNC(c1cc(Nc2ccc(c(c2)OC)OC)nc2ccccc12)=O)Cc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.7895 |
| logD: | 3.3484 |
| logSw: | -4.7299 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.659 |
| InChI Key: | POXZVNNFOAVHQN-UHFFFAOYSA-N |