N-(2-ethylphenyl)-4-{methyl[(oxolan-2-yl)methyl]amino}piperidine-1-carbothioamide
Chemical Structure Depiction of
N-(2-ethylphenyl)-4-{methyl[(oxolan-2-yl)methyl]amino}piperidine-1-carbothioamide
N-(2-ethylphenyl)-4-{methyl[(oxolan-2-yl)methyl]amino}piperidine-1-carbothioamide
Compound characteristics
| Compound ID: | K788-6430 |
| Compound Name: | N-(2-ethylphenyl)-4-{methyl[(oxolan-2-yl)methyl]amino}piperidine-1-carbothioamide |
| Molecular Weight: | 361.55 |
| Molecular Formula: | C20 H31 N3 O S |
| Smiles: | CCc1ccccc1NC(N1CCC(CC1)N(C)CC1CCCO1)=S |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6665 |
| logD: | 2.2495 |
| logSw: | -3.7106 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 21.6888 |
| InChI Key: | IEHPNLKEYRRHGJ-GOSISDBHSA-N |