4-[cyclopentyl(methyl)amino]-N-[3-(methylsulfanyl)phenyl]piperidine-1-carbothioamide
Chemical Structure Depiction of
4-[cyclopentyl(methyl)amino]-N-[3-(methylsulfanyl)phenyl]piperidine-1-carbothioamide
4-[cyclopentyl(methyl)amino]-N-[3-(methylsulfanyl)phenyl]piperidine-1-carbothioamide
Compound characteristics
| Compound ID: | K788-6469 |
| Compound Name: | 4-[cyclopentyl(methyl)amino]-N-[3-(methylsulfanyl)phenyl]piperidine-1-carbothioamide |
| Molecular Weight: | 363.59 |
| Molecular Formula: | C19 H29 N3 S2 |
| Smiles: | CN(C1CCCC1)C1CCN(CC1)C(Nc1cccc(c1)SC)=S |
| Stereo: | ACHIRAL |
| logP: | 4.6538 |
| logD: | 1.328 |
| logSw: | -4.3585 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 13.1499 |
| InChI Key: | BPMOZRZGWRJIDF-UHFFFAOYSA-N |