N-{2-[ethyl(phenyl)amino]ethyl}-4-({4-[(3-methylphenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-ylidene}methyl)benzamide
Chemical Structure Depiction of
N-{2-[ethyl(phenyl)amino]ethyl}-4-({4-[(3-methylphenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-ylidene}methyl)benzamide
N-{2-[ethyl(phenyl)amino]ethyl}-4-({4-[(3-methylphenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-ylidene}methyl)benzamide
Compound characteristics
| Compound ID: | K788-8123 |
| Compound Name: | N-{2-[ethyl(phenyl)amino]ethyl}-4-({4-[(3-methylphenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-ylidene}methyl)benzamide |
| Molecular Weight: | 547.72 |
| Molecular Formula: | C34 H33 N3 O2 S |
| Smiles: | CCN(CCNC(c1ccc(\C=C2/C(N(Cc3cccc(C)c3)c3ccccc3S2)=O)cc1)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 7.1851 |
| logD: | 7.1843 |
| logSw: | -5.6118 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.314 |
| InChI Key: | NTDCKKBRYKIMCU-UHFFFAOYSA-N |