7-chloro-5-(2-fluorophenyl)-3-methyl-1-{[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl}-1,3-dihydro-2H-1,4-benzodiazepin-2-one
Chemical Structure Depiction of
7-chloro-5-(2-fluorophenyl)-3-methyl-1-{[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl}-1,3-dihydro-2H-1,4-benzodiazepin-2-one
7-chloro-5-(2-fluorophenyl)-3-methyl-1-{[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl}-1,3-dihydro-2H-1,4-benzodiazepin-2-one
Compound characteristics
| Compound ID: | K788-9426 |
| Compound Name: | 7-chloro-5-(2-fluorophenyl)-3-methyl-1-{[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl}-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
| Molecular Weight: | 487.96 |
| Molecular Formula: | C28 H23 Cl F N3 O2 |
| Smiles: | CC1C(N(Cc2c(C)oc(c3ccccc3C)n2)c2ccc(cc2C(c2ccccc2F)=N1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4676 |
| logD: | 5.4676 |
| logSw: | -5.7833 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 41.842 |
| InChI Key: | WQRJLUKCZSUCOZ-QGZVFWFLSA-N |