2-benzylidene-6-(4-methylpiperazine-1-carbonyl)-2H-1,4-benzothiazin-3(4H)-one
Chemical Structure Depiction of
2-benzylidene-6-(4-methylpiperazine-1-carbonyl)-2H-1,4-benzothiazin-3(4H)-one
2-benzylidene-6-(4-methylpiperazine-1-carbonyl)-2H-1,4-benzothiazin-3(4H)-one
Compound characteristics
| Compound ID: | K788-9547 |
| Compound Name: | 2-benzylidene-6-(4-methylpiperazine-1-carbonyl)-2H-1,4-benzothiazin-3(4H)-one |
| Molecular Weight: | 379.48 |
| Molecular Formula: | C21 H21 N3 O2 S |
| Smiles: | CN1CCN(CC1)C(c1ccc2c(c1)NC(/C(=C/c1ccccc1)S2)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7301 |
| logD: | 2.5994 |
| logSw: | -3.4378 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.969 |
| InChI Key: | IHSGWBYMRMKWDQ-UHFFFAOYSA-N |