N-[2-(4-ethoxyphenyl)ethyl]-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-carboxamide
Chemical Structure Depiction of
N-[2-(4-ethoxyphenyl)ethyl]-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-carboxamide
N-[2-(4-ethoxyphenyl)ethyl]-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-carboxamide
Compound characteristics
| Compound ID: | K788-9565 |
| Compound Name: | N-[2-(4-ethoxyphenyl)ethyl]-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-carboxamide |
| Molecular Weight: | 472.61 |
| Molecular Formula: | C28 H28 N2 O3 S |
| Smiles: | CCOc1ccc(CCNC(c2ccc3c(c2)N(C)C(/C(=C\c2cccc(C)c2)S3)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.1361 |
| logD: | 5.1361 |
| logSw: | -4.904 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.485 |
| InChI Key: | MCAHGNPUELYCAI-UHFFFAOYSA-N |