N-(2,5-dimethoxyphenyl)-2-{[(2,3-dimethoxyphenyl)methyl]amino}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Chemical Structure Depiction of
N-(2,5-dimethoxyphenyl)-2-{[(2,3-dimethoxyphenyl)methyl]amino}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
N-(2,5-dimethoxyphenyl)-2-{[(2,3-dimethoxyphenyl)methyl]amino}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Compound characteristics
| Compound ID: | K801-0266 |
| Compound Name: | N-(2,5-dimethoxyphenyl)-2-{[(2,3-dimethoxyphenyl)methyl]amino}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| Molecular Weight: | 482.6 |
| Molecular Formula: | C26 H30 N2 O5 S |
| Smiles: | COc1ccc(c(c1)NC(c1c2CCCCc2sc1NCc1cccc(c1OC)OC)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 5.2849 |
| logD: | 5.2836 |
| logSw: | -5.2561 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.103 |
| InChI Key: | XMGDIICUPGXKQQ-UHFFFAOYSA-N |