N-(4-ethoxyphenyl)-6-methyl-2-{[(2,3,4-trimethoxyphenyl)methyl]amino}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-6-methyl-2-{[(2,3,4-trimethoxyphenyl)methyl]amino}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
N-(4-ethoxyphenyl)-6-methyl-2-{[(2,3,4-trimethoxyphenyl)methyl]amino}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Compound characteristics
| Compound ID: | K801-0532 |
| Compound Name: | N-(4-ethoxyphenyl)-6-methyl-2-{[(2,3,4-trimethoxyphenyl)methyl]amino}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| Molecular Weight: | 510.65 |
| Molecular Formula: | C28 H34 N2 O5 S |
| Smiles: | CCOc1ccc(cc1)NC(c1c2CCC(C)Cc2sc1NCc1ccc(c(c1OC)OC)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1282 |
| logD: | 6.1282 |
| logSw: | -5.6209 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.467 |
| InChI Key: | GHDCTKVQJBVTNT-QGZVFWFLSA-N |