2-{4-[benzyl(methyl)amino]-3-nitrophenyl}hexahydro-1H-isoindole-1,3(2H)-dione
					Chemical Structure Depiction of
2-{4-[benzyl(methyl)amino]-3-nitrophenyl}hexahydro-1H-isoindole-1,3(2H)-dione
			2-{4-[benzyl(methyl)amino]-3-nitrophenyl}hexahydro-1H-isoindole-1,3(2H)-dione
Compound characteristics
| Compound ID: | K807-0124 | 
| Compound Name: | 2-{4-[benzyl(methyl)amino]-3-nitrophenyl}hexahydro-1H-isoindole-1,3(2H)-dione | 
| Molecular Weight: | 393.44 | 
| Molecular Formula: | C22 H23 N3 O4 | 
| Smiles: | CN(Cc1ccccc1)c1ccc(cc1[N+]([O-])=O)N1C(C2CCCCC2C1=O)=O | 
| Stereo: | MIXTURE OF STEREOISOMERS | 
| logP: | 3.3587 | 
| logD: | 3.3587 | 
| logSw: | -3.72 | 
| Hydrogen bond acceptors count: | 8 | 
| Polar surface area: | 64.806 | 
| InChI Key: | ALAOOVLCGDFMBH-UHFFFAOYSA-N | 
 
				 
				