1-(4-{[(3,5-dimethoxyphenyl)methyl]amino}-3-nitrophenyl)-3-methylpyrrolidine-2,5-dione
Chemical Structure Depiction of
1-(4-{[(3,5-dimethoxyphenyl)methyl]amino}-3-nitrophenyl)-3-methylpyrrolidine-2,5-dione
1-(4-{[(3,5-dimethoxyphenyl)methyl]amino}-3-nitrophenyl)-3-methylpyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | K807-4395 |
| Compound Name: | 1-(4-{[(3,5-dimethoxyphenyl)methyl]amino}-3-nitrophenyl)-3-methylpyrrolidine-2,5-dione |
| Molecular Weight: | 399.4 |
| Molecular Formula: | C20 H21 N3 O6 |
| Smiles: | CC1CC(N(C1=O)c1ccc(c(c1)[N+]([O-])=O)NCc1cc(cc(c1)OC)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4754 |
| logD: | 2.4754 |
| logSw: | -2.9543 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 87.134 |
| InChI Key: | MBPJGOLCMXGJEO-GFCCVEGCSA-N |