1-{3-nitro-4-[4-(pentyloxy)anilino]phenyl}pyrrolidine-2,5-dione
Chemical Structure Depiction of
1-{3-nitro-4-[4-(pentyloxy)anilino]phenyl}pyrrolidine-2,5-dione
1-{3-nitro-4-[4-(pentyloxy)anilino]phenyl}pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | K807-5036 |
| Compound Name: | 1-{3-nitro-4-[4-(pentyloxy)anilino]phenyl}pyrrolidine-2,5-dione |
| Molecular Weight: | 397.43 |
| Molecular Formula: | C21 H23 N3 O5 |
| Smiles: | CCCCCOc1ccc(cc1)Nc1ccc(cc1[N+]([O-])=O)N1C(CCC1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2294 |
| logD: | 4.2294 |
| logSw: | -4.1874 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.42 |
| InChI Key: | PRFVWORDXVSDQZ-UHFFFAOYSA-N |