1-[4-(cycloheptylamino)-3-nitrophenyl]pyrrolidine-2,5-dione
Chemical Structure Depiction of
1-[4-(cycloheptylamino)-3-nitrophenyl]pyrrolidine-2,5-dione
1-[4-(cycloheptylamino)-3-nitrophenyl]pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | K807-5180 |
| Compound Name: | 1-[4-(cycloheptylamino)-3-nitrophenyl]pyrrolidine-2,5-dione |
| Molecular Weight: | 331.37 |
| Molecular Formula: | C17 H21 N3 O4 |
| Smiles: | C1CCCC(CC1)Nc1ccc(cc1[N+]([O-])=O)N1C(CCC1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5306 |
| logD: | 2.5306 |
| logSw: | -2.9221 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.381 |
| InChI Key: | NIAAXQHDPMTCCH-UHFFFAOYSA-N |