1-(4-{[(naphthalen-1-yl)methyl]amino}-3-nitrophenyl)piperidine-2,6-dione
Chemical Structure Depiction of
1-(4-{[(naphthalen-1-yl)methyl]amino}-3-nitrophenyl)piperidine-2,6-dione
1-(4-{[(naphthalen-1-yl)methyl]amino}-3-nitrophenyl)piperidine-2,6-dione
Compound characteristics
| Compound ID: | K807-5979 |
| Compound Name: | 1-(4-{[(naphthalen-1-yl)methyl]amino}-3-nitrophenyl)piperidine-2,6-dione |
| Molecular Weight: | 389.41 |
| Molecular Formula: | C22 H19 N3 O4 |
| Smiles: | C1CC(N(C(C1)=O)c1ccc(c(c1)[N+]([O-])=O)NCc1cccc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.348 |
| logD: | 3.348 |
| logSw: | -3.6984 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.687 |
| InChI Key: | UCRIYHUAZFODQK-UHFFFAOYSA-N |