1-{4-[(2-methoxyethyl)amino]-3-nitrophenyl}piperidine-2,6-dione
Chemical Structure Depiction of
1-{4-[(2-methoxyethyl)amino]-3-nitrophenyl}piperidine-2,6-dione
1-{4-[(2-methoxyethyl)amino]-3-nitrophenyl}piperidine-2,6-dione
Compound characteristics
| Compound ID: | K807-6132 |
| Compound Name: | 1-{4-[(2-methoxyethyl)amino]-3-nitrophenyl}piperidine-2,6-dione |
| Molecular Weight: | 307.3 |
| Molecular Formula: | C14 H17 N3 O5 |
| Smiles: | COCCNc1ccc(cc1[N+]([O-])=O)N1C(CCCC1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.8088 |
| logD: | 0.8088 |
| logSw: | -2.1985 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.414 |
| InChI Key: | FBDZCYAIFSBZCF-UHFFFAOYSA-N |