ethyl 1-[4-(2,6-dioxopiperidin-1-yl)-2-nitrophenyl]piperidine-3-carboxylate
Chemical Structure Depiction of
ethyl 1-[4-(2,6-dioxopiperidin-1-yl)-2-nitrophenyl]piperidine-3-carboxylate
ethyl 1-[4-(2,6-dioxopiperidin-1-yl)-2-nitrophenyl]piperidine-3-carboxylate
Compound characteristics
| Compound ID: | K807-6144 |
| Compound Name: | ethyl 1-[4-(2,6-dioxopiperidin-1-yl)-2-nitrophenyl]piperidine-3-carboxylate |
| Molecular Weight: | 389.41 |
| Molecular Formula: | C19 H23 N3 O6 |
| Smiles: | CCOC(C1CCCN(C1)c1ccc(cc1[N+]([O-])=O)N1C(CCCC1=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.3492 |
| logD: | 1.3492 |
| logSw: | -2.2089 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 86.26 |
| InChI Key: | VXIBKJGAUZHMSA-ZDUSSCGKSA-N |