1-[4-(azocan-1-yl)-3-nitrophenyl]piperidine-2,6-dione
Chemical Structure Depiction of
1-[4-(azocan-1-yl)-3-nitrophenyl]piperidine-2,6-dione
1-[4-(azocan-1-yl)-3-nitrophenyl]piperidine-2,6-dione
Compound characteristics
| Compound ID: | K807-6180 |
| Compound Name: | 1-[4-(azocan-1-yl)-3-nitrophenyl]piperidine-2,6-dione |
| Molecular Weight: | 345.4 |
| Molecular Formula: | C18 H23 N3 O4 |
| Smiles: | C1CCCN(CCC1)c1ccc(cc1[N+]([O-])=O)N1C(CCCC1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6083 |
| logD: | 2.6083 |
| logSw: | -3.0536 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 65.904 |
| InChI Key: | UBXPFBONJQNNNB-UHFFFAOYSA-N |