1-[4-(4-fluorophenyl)piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one
Chemical Structure Depiction of
1-[4-(4-fluorophenyl)piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one
1-[4-(4-fluorophenyl)piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one
Compound characteristics
| Compound ID: | K808-0847 |
| Compound Name: | 1-[4-(4-fluorophenyl)piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one |
| Molecular Weight: | 365.45 |
| Molecular Formula: | C22 H24 F N3 O |
| Smiles: | C(CC(N1CCN(CC1)c1ccc(cc1)F)=O)Cc1c[nH]c2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 3.7796 |
| logD: | 3.7796 |
| logSw: | -4.0606 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.4904 |
| InChI Key: | ZDPMFCDPEQYOJJ-UHFFFAOYSA-N |