5-bromo-N-(2,3-dimethylphenyl)furan-2-carboxamide
Chemical Structure Depiction of
5-bromo-N-(2,3-dimethylphenyl)furan-2-carboxamide
5-bromo-N-(2,3-dimethylphenyl)furan-2-carboxamide
Compound characteristics
| Compound ID: | K808-8850 |
| Compound Name: | 5-bromo-N-(2,3-dimethylphenyl)furan-2-carboxamide |
| Molecular Weight: | 294.15 |
| Molecular Formula: | C13 H12 Br N O2 |
| Smiles: | Cc1cccc(c1C)NC(c1ccc(o1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 3.9869 |
| logD: | 3.985 |
| logSw: | -4.1769 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.5577 |
| InChI Key: | BVIYPQWSJUZYSC-UHFFFAOYSA-N |