diethyl 1-(3,5-dimethylphenyl)-4-(3-fluorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
Chemical Structure Depiction of
diethyl 1-(3,5-dimethylphenyl)-4-(3-fluorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
diethyl 1-(3,5-dimethylphenyl)-4-(3-fluorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
Compound characteristics
| Compound ID: | K813-0021 |
| Compound Name: | diethyl 1-(3,5-dimethylphenyl)-4-(3-fluorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Weight: | 423.48 |
| Molecular Formula: | C25 H26 F N O4 |
| Smiles: | CCOC(C1=CN(C=C(C1c1cccc(c1)F)C(=O)OCC)c1cc(C)cc(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4046 |
| logD: | 5.4046 |
| logSw: | -5.4378 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.156 |
| InChI Key: | JSQQPMXTJFYYPM-UHFFFAOYSA-N |