diethyl 1,2,6-trimethyl-4-(thiophen-3-yl)-1,4-dihydropyridine-3,5-dicarboxylate
Chemical Structure Depiction of
diethyl 1,2,6-trimethyl-4-(thiophen-3-yl)-1,4-dihydropyridine-3,5-dicarboxylate
diethyl 1,2,6-trimethyl-4-(thiophen-3-yl)-1,4-dihydropyridine-3,5-dicarboxylate
Compound characteristics
| Compound ID: | K813-0098 |
| Compound Name: | diethyl 1,2,6-trimethyl-4-(thiophen-3-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Weight: | 349.45 |
| Molecular Formula: | C18 H23 N O4 S |
| Smiles: | CCOC(C1C(C(=C(C)N(C)C=1C)C(=O)OCC)c1ccsc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.112 |
| logD: | 3.112 |
| logSw: | -3.0126 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.579 |
| InChI Key: | MVFPBEURBHRCAM-UHFFFAOYSA-N |