diethyl 1-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1H-pyrrole-3,4-dicarboxylate
Chemical Structure Depiction of
diethyl 1-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1H-pyrrole-3,4-dicarboxylate
diethyl 1-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1H-pyrrole-3,4-dicarboxylate
Compound characteristics
| Compound ID: | K815-0009 |
| Compound Name: | diethyl 1-[2-(1H-indol-3-yl)ethyl]-2,5-dimethyl-1H-pyrrole-3,4-dicarboxylate |
| Molecular Weight: | 382.46 |
| Molecular Formula: | C22 H26 N2 O4 |
| Smiles: | CCOC(c1c(C(=O)OCC)c(C)n(CCc2c[nH]c3ccccc23)c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8111 |
| logD: | 3.8111 |
| logSw: | -4.1361 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.292 |
| InChI Key: | DKDASDXFVHOAAZ-UHFFFAOYSA-N |