5'-(4-methoxyphenyl)-1',3',3'-trimethyl-6-nitro-1',3'-dihydrospiro[[1]benzopyran-2,2'-indole]
Chemical Structure Depiction of
5'-(4-methoxyphenyl)-1',3',3'-trimethyl-6-nitro-1',3'-dihydrospiro[[1]benzopyran-2,2'-indole]
5'-(4-methoxyphenyl)-1',3',3'-trimethyl-6-nitro-1',3'-dihydrospiro[[1]benzopyran-2,2'-indole]
Compound characteristics
| Compound ID: | K815-0551 |
| Compound Name: | 5'-(4-methoxyphenyl)-1',3',3'-trimethyl-6-nitro-1',3'-dihydrospiro[[1]benzopyran-2,2'-indole] |
| Molecular Weight: | 428.49 |
| Molecular Formula: | C26 H24 N2 O4 |
| Smiles: | CC1(C)c2cc(ccc2N(C)C12C=Cc1cc(ccc1O2)[N+]([O-])=O)c1ccc(cc1)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.5433 |
| logD: | 6.5433 |
| logSw: | -5.8058 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.086 |
| InChI Key: | ZXFBAILMMWPNPV-AREMUKBSSA-N |