3-ethyl-N-(4-fluorophenyl)-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxamide
Chemical Structure Depiction of
3-ethyl-N-(4-fluorophenyl)-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxamide
3-ethyl-N-(4-fluorophenyl)-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxamide
Compound characteristics
| Compound ID: | K821-0042 |
| Compound Name: | 3-ethyl-N-(4-fluorophenyl)-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxamide |
| Molecular Weight: | 331.37 |
| Molecular Formula: | C16 H14 F N3 O2 S |
| Smiles: | CCN1C=Nc2c(C1=O)c(C)c(C(Nc1ccc(cc1)F)=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 2.4236 |
| logD: | 2.3727 |
| logSw: | -2.8816 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.329 |
| InChI Key: | OUWTWTYJWAENKR-UHFFFAOYSA-N |