3-ethyl-5-methyl-4-oxo-N-(4-phenoxyphenyl)-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxamide
Chemical Structure Depiction of
3-ethyl-5-methyl-4-oxo-N-(4-phenoxyphenyl)-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxamide
3-ethyl-5-methyl-4-oxo-N-(4-phenoxyphenyl)-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxamide
Compound characteristics
| Compound ID: | K821-0062 |
| Compound Name: | 3-ethyl-5-methyl-4-oxo-N-(4-phenoxyphenyl)-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxamide |
| Molecular Weight: | 405.47 |
| Molecular Formula: | C22 H19 N3 O3 S |
| Smiles: | CCN1C=Nc2c(C1=O)c(C)c(C(Nc1ccc(cc1)Oc1ccccc1)=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 4.0847 |
| logD: | 4.0835 |
| logSw: | -4.2666 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.076 |
| InChI Key: | VKBXCAHGWGNLBU-UHFFFAOYSA-N |