diethyl 4-(4-chlorophenyl)-1-(propan-2-yl)-1,4-dihydropyridine-3,5-dicarboxylate
Chemical Structure Depiction of
diethyl 4-(4-chlorophenyl)-1-(propan-2-yl)-1,4-dihydropyridine-3,5-dicarboxylate
diethyl 4-(4-chlorophenyl)-1-(propan-2-yl)-1,4-dihydropyridine-3,5-dicarboxylate
Compound characteristics
| Compound ID: | K837-0869 |
| Compound Name: | diethyl 4-(4-chlorophenyl)-1-(propan-2-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Weight: | 377.87 |
| Molecular Formula: | C20 H24 Cl N O4 |
| Smiles: | CCOC(C1=CN(C=C(C1c1ccc(cc1)[Cl])C(=O)OCC)C(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.996 |
| logD: | 3.996 |
| logSw: | -4.841 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.76 |
| InChI Key: | ZGFVWAZGPOOATK-UHFFFAOYSA-N |