dimethyl 4-(3-chlorophenyl)-1-[(4-fluorophenyl)methyl]-1,4-dihydropyridine-3,5-dicarboxylate
Chemical Structure Depiction of
dimethyl 4-(3-chlorophenyl)-1-[(4-fluorophenyl)methyl]-1,4-dihydropyridine-3,5-dicarboxylate
dimethyl 4-(3-chlorophenyl)-1-[(4-fluorophenyl)methyl]-1,4-dihydropyridine-3,5-dicarboxylate
Compound characteristics
| Compound ID: | K837-1522 |
| Compound Name: | dimethyl 4-(3-chlorophenyl)-1-[(4-fluorophenyl)methyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Weight: | 415.85 |
| Molecular Formula: | C22 H19 Cl F N O4 |
| Smiles: | COC(C1=CN(Cc2ccc(cc2)F)C=C(C1c1cccc(c1)[Cl])C(=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1688 |
| logD: | 4.1688 |
| logSw: | -4.517 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.277 |
| InChI Key: | UYMDQMKCWVTMKT-UHFFFAOYSA-N |