2-{[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl}-3-[4-(difluoromethoxy)phenyl]quinazolin-4(3H)-one
Chemical Structure Depiction of
2-{[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl}-3-[4-(difluoromethoxy)phenyl]quinazolin-4(3H)-one
2-{[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl}-3-[4-(difluoromethoxy)phenyl]quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | K843-0027 |
| Compound Name: | 2-{[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl}-3-[4-(difluoromethoxy)phenyl]quinazolin-4(3H)-one |
| Molecular Weight: | 472.9 |
| Molecular Formula: | C23 H15 Cl F2 N2 O3 S |
| Smiles: | C(C(c1ccc(cc1)[Cl])=O)SC1=Nc2ccccc2C(N1c1ccc(cc1)OC(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3815 |
| logD: | 4.3812 |
| logSw: | -4.7698 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 45.012 |
| InChI Key: | WQHIVNDDBVHWGS-UHFFFAOYSA-N |