N-[(4-fluorophenyl)methyl]-4-hydroxy-1-methyl-2-oxo-1,2-dihydroquinoline-3-carboxamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-4-hydroxy-1-methyl-2-oxo-1,2-dihydroquinoline-3-carboxamide
N-[(4-fluorophenyl)methyl]-4-hydroxy-1-methyl-2-oxo-1,2-dihydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | K844-0836 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-4-hydroxy-1-methyl-2-oxo-1,2-dihydroquinoline-3-carboxamide |
| Molecular Weight: | 326.33 |
| Molecular Formula: | C18 H15 F N2 O3 |
| Smiles: | CN1C(C(=C(c2ccccc12)O)C(NCc1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.4822 |
| logD: | -0.6385 |
| logSw: | -2.3799 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.863 |
| InChI Key: | CUHZYGMWPZBTOA-UHFFFAOYSA-N |