3-(2-ethoxyethyl)-N-(2-ethoxyphenyl)-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxamide
Chemical Structure Depiction of
3-(2-ethoxyethyl)-N-(2-ethoxyphenyl)-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxamide
3-(2-ethoxyethyl)-N-(2-ethoxyphenyl)-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxamide
Compound characteristics
| Compound ID: | K852-0338 |
| Compound Name: | 3-(2-ethoxyethyl)-N-(2-ethoxyphenyl)-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxamide |
| Molecular Weight: | 401.48 |
| Molecular Formula: | C20 H23 N3 O4 S |
| Smiles: | CCOCCN1C=Nc2c(C1=O)c(C)c(C(Nc1ccccc1OCC)=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 2.8094 |
| logD: | 2.787 |
| logSw: | -3.2809 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.072 |
| InChI Key: | RTCFCDAOAGNATO-UHFFFAOYSA-N |