[5-methyl-4-(4-methylpiperidin-1-yl)thieno[2,3-d]pyrimidin-6-yl](4-phenylpiperazin-1-yl)methanone
Chemical Structure Depiction of
[5-methyl-4-(4-methylpiperidin-1-yl)thieno[2,3-d]pyrimidin-6-yl](4-phenylpiperazin-1-yl)methanone
[5-methyl-4-(4-methylpiperidin-1-yl)thieno[2,3-d]pyrimidin-6-yl](4-phenylpiperazin-1-yl)methanone
Compound characteristics
| Compound ID: | K889-0761 |
| Compound Name: | [5-methyl-4-(4-methylpiperidin-1-yl)thieno[2,3-d]pyrimidin-6-yl](4-phenylpiperazin-1-yl)methanone |
| Molecular Weight: | 435.59 |
| Molecular Formula: | C24 H29 N5 O S |
| Smiles: | CC1CCN(CC1)c1c2c(C)c(C(N3CCN(CC3)c3ccccc3)=O)sc2ncn1 |
| Stereo: | ACHIRAL |
| logP: | 4.9223 |
| logD: | 4.8079 |
| logSw: | -4.765 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 44.447 |
| InChI Key: | HQTCSQORELRRKP-UHFFFAOYSA-N |