6-chloro-N~2~-cyclohexyl-N~4~-(4-iodo-2-methylphenyl)-1,3,5-triazine-2,4-diamine
Chemical Structure Depiction of
6-chloro-N~2~-cyclohexyl-N~4~-(4-iodo-2-methylphenyl)-1,3,5-triazine-2,4-diamine
6-chloro-N~2~-cyclohexyl-N~4~-(4-iodo-2-methylphenyl)-1,3,5-triazine-2,4-diamine
Compound characteristics
| Compound ID: | K890-0080 |
| Compound Name: | 6-chloro-N~2~-cyclohexyl-N~4~-(4-iodo-2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| Molecular Weight: | 443.72 |
| Molecular Formula: | C16 H19 Cl I N5 |
| Smiles: | Cc1cc(ccc1Nc1nc(NC2CCCCC2)nc(n1)[Cl])I |
| Stereo: | ACHIRAL |
| logP: | 6.7431 |
| logD: | 6.7431 |
| logSw: | -6.4918 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 50.282 |
| InChI Key: | BVGFSZYGEHEHEJ-UHFFFAOYSA-N |